Products 1332528-63-8
CAS 1332528-63-8 is the registry number for 2-(2-Chloroimidazo[2,1-b]thiazol-6-yl)acetic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chloroimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid;hydrochloride (CAS 1332528-63-8) is a chemical compound with the molecular formula C7H6Cl2N2O2S and a molecular weight of 253.11 g/mol. IUPAC name: 2-(2-chloroimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid;hydrochloride. InChIKey: QVGCQLLNCOJGBR-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O2S |
|---|---|
| Molecular weight | 253.11 g/mol |
| IUPAC name | 2-(2-chloroimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid;hydrochloride |
| InChIKey | QVGCQLLNCOJGBR-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2N1C=C(S2)Cl)CC(=O)O.Cl |
Computed by PubChem (NCBI)