CAS 1956321-85-9 is the registry number for 1h-1,3-benzodiazole-5-sulfonyl Chloride Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
3H-benzimidazole-5-sulfonyl chloride;hydrochloride (CAS 1956321-85-9) is a chemical compound with the molecular formula C7H6Cl2N2O2S and a molecular weight of 253.11 g/mol. IUPAC name: 3H-benzimidazole-5-sulfonyl chloride;hydrochloride. InChIKey: XESBSBJNPJQJAV-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O2S |
|---|---|
| Molecular weight | 253.11 g/mol |
| IUPAC name | 3H-benzimidazole-5-sulfonyl chloride;hydrochloride |
| InChIKey | XESBSBJNPJQJAV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)Cl)NC=N2.Cl |
Computed by PubChem (NCBI)