Products 1332530-45-6

CAS 1332530-45-6 appears in our catalog under these names: 6-Azaspiro(2.5)octane-1-carboxylic acid hydrochloride, 6-Azaspiro[2.5]octane-1-carboxylic acid hydrochloride, 95%, 95%, 6-Azaspiro[2.5]octane-1-carboxylic acid hydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

6-azaspiro[2.5]octane-2-carboxylic acid;hydrochloride (CAS 1332530-45-6) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: 6-azaspiro[2.5]octane-2-carboxylic acid;hydrochloride. InChIKey: VFEIJLDQEVDHOR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClNO2
Molecular weight191.65 g/mol
IUPAC name6-azaspiro[2.5]octane-2-carboxylic acid;hydrochloride
InChIKeyVFEIJLDQEVDHOR-UHFFFAOYSA-N
SMILESC1CNCCC12CC2C(=O)O.Cl

Computed by PubChem (NCBI)