CAS 1332581-65-3 is the registry number for 2,3-Difluoro-6-methoxy-phenylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2,3-difluoro-6-methoxyaniline;hydrochloride (CAS 1332581-65-3) is a chemical compound with the molecular formula C7H8ClF2NO and a molecular weight of 195.59 g/mol. IUPAC name: 2,3-difluoro-6-methoxyaniline;hydrochloride. InChIKey: GAZYPHRRMWZANX-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF2NO |
|---|---|
| Molecular weight | 195.59 g/mol |
| IUPAC name | 2,3-difluoro-6-methoxyaniline;hydrochloride |
| InChIKey | GAZYPHRRMWZANX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)