Products 1965309-92-5

CAS 1965309-92-5 is the registry number for 4,5-Difluoro-2-methoxy-phenylamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4,5-difluoro-2-methoxyaniline;hydrochloride (CAS 1965309-92-5) is a chemical compound with the molecular formula C7H8ClF2NO and a molecular weight of 195.59 g/mol. IUPAC name: 4,5-difluoro-2-methoxyaniline;hydrochloride. InChIKey: ODVBJANUXGNOME-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8ClF2NO
Molecular weight195.59 g/mol
IUPAC name4,5-difluoro-2-methoxyaniline;hydrochloride
InChIKeyODVBJANUXGNOME-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1N)F)F.Cl

Computed by PubChem (NCBI)