Products 1332609-76-3
CAS 1332609-76-3 is the registry number for Rel-methyl (1S,2R,3R,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (1S,2R,3R,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylate (CAS 1332609-76-3) is a chemical compound with the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. IUPAC name: methyl (1S,2R,3R,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylate. InChIKey: QIDKPXAOMOVSBB-LXGUWJNJSA-N.
| Molecular formula | C9H15NO2 |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | methyl (1S,2R,3R,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | QIDKPXAOMOVSBB-LXGUWJNJSA-N |
| SMILES | COC(=O)[C@@H]1[C@H]2CC[C@H](C2)[C@H]1N |
Computed by PubChem (NCBI)