Products 2055118-14-2
CAS 2055118-14-2 appears in our catalog under these names: (3aS，7aS)–Octahydro–1H–indole–2–carboxylic acid, (3As,7as)-octahydro-1h-indole-2-carboxylic acid, 95%. Offered by: GLPBio, Combi-blocks, Chemat Brand. Available pack sizes: 100mg, 250mg, 1g, 5g, on request.
(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid (CAS 2055118-14-2) is a chemical compound with the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. IUPAC name: (3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid. InChIKey: CQYBNXGHMBNGCG-WPZUCAASSA-N.
| Molecular formula | C9H15NO2 |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | (3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylic acid |
| InChIKey | CQYBNXGHMBNGCG-WPZUCAASSA-N |
| SMILES | C1CC[C@H]2[C@@H](C1)CC(N2)C(=O)O |
Computed by PubChem (NCBI)