CAS 1332965-90-8 appears in our catalog under these names: Diisononyl Phthalate-d4, Diisononyl Phthalate-d4, >95% (HPLC), Bis(7-methyl-1-octyl) Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, DINP-d4, Bis(7-methyl-1-octyl) Phthalate-3,4,5,6-d4. Offered by: Chemat Brand, TRC, CDN, TargetMol, MedChemExpress. Available pack sizes: on request, 100mg, 250mg, 5mg, 0,1g, 0,05g, 1mg, 10mg.
Bis(7-methyloctyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 1332965-90-8) is a chemical compound with the molecular formula C26H42O4 and a molecular weight of 422.6 g/mol. IUPAC name: bis(7-methyloctyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: HBGGXOJOCNVPFY-ODMBGTAASA-N.
| Molecular formula | C26H42O4 |
|---|---|
| Molecular weight | 422.6 g/mol |
| IUPAC name | bis(7-methyloctyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | HBGGXOJOCNVPFY-ODMBGTAASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCCCCC(C)C)C(=O)OCCCCCCC(C)C)[2H])[2H] |
Computed by PubChem (NCBI)