CAS 84-76-4 appears in our catalog under these names: Dinonyl phthalate, 95%, Dinonyl Phthalate, Phthalic acid, bis-nonyl ester, Dinonyl Phthalate (mixture of isomers), Dinonyl phthalate(mixture of isomers). Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 100g, 25g, 1g, 250mg, 10l, 2,5l, 500ml.
Dinonyl benzene-1,2-dicarboxylate (CAS 84-76-4) is a chemical compound with the molecular formula C26H42O4 and a molecular weight of 418.6 g/mol. IUPAC name: dinonyl benzene-1,2-dicarboxylate. InChIKey: DROMNWUQASBTFM-UHFFFAOYSA-N.
| Molecular formula | C26H42O4 |
|---|---|
| Molecular weight | 418.6 g/mol |
| IUPAC name | dinonyl benzene-1,2-dicarboxylate |
| InChIKey | DROMNWUQASBTFM-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCC |
Computed by PubChem (NCBI)