Products 1333112-55-2

CAS 1333112-55-2 is the registry number for Pioglitazone hydrochloride Impurity 26. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanamide (CAS 1333112-55-2) is a chemical compound with the molecular formula C18H22N2O2 and a molecular weight of 298.4 g/mol. IUPAC name: 3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanamide. InChIKey: JUEUDSTYQSRZCP-UHFFFAOYSA-N.

Identity
Molecular formulaC18H22N2O2
Molecular weight298.4 g/mol
IUPAC name3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanamide
InChIKeyJUEUDSTYQSRZCP-UHFFFAOYSA-N
SMILESCCC1=CN=C(C=C1)CCOC2=CC=C(C=C2)CCC(=O)N

Computed by PubChem (NCBI)