Products 657405-94-2
CAS 657405-94-2 is the registry number for 1-(7-Nitro-1,1,3,3,6-pentamethylindan-5-yl)-1h-pyrrole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-yl)pyrrole (CAS 657405-94-2) is a chemical compound with the molecular formula C18H22N2O2 and a molecular weight of 298.4 g/mol. IUPAC name: 1-(1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-yl)pyrrole. InChIKey: QBTFBQFAURJLIF-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 1-(1,1,3,3,6-pentamethyl-7-nitro-2H-inden-5-yl)pyrrole |
| InChIKey | QBTFBQFAURJLIF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1[N+](=O)[O-])C(CC2(C)C)(C)C)N3C=CC=C3 |
Computed by PubChem (NCBI)