CAS 133330-61-7 appears in our catalog under these names: Loratadine Impurity 7, Loratadine Impurity 34, Loratadine Impurity 48. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (CAS 133330-61-7) is a chemical compound with the molecular formula C14H9Cl2NO and a molecular weight of 278.1 g/mol. IUPAC name: 5,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one. InChIKey: HGCFDJOSJCJZAR-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NO |
|---|---|
| Molecular weight | 278.1 g/mol |
| IUPAC name | 5,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| InChIKey | HGCFDJOSJCJZAR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(=O)C3=C1C=CC(=N3)Cl |
Computed by PubChem (NCBI)