Products 133330-72-0
CAS 133330-72-0 appears in our catalog under these names: Loratadine Impurity 42, Loratadine Impurity 17, Loratadine Impurity 45. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ol (CAS 133330-72-0) is a chemical compound with the molecular formula C14H12ClNO and a molecular weight of 245.70 g/mol. IUPAC name: 13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ol. InChIKey: BCSASULZFIFFIN-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | 13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ol |
| InChIKey | BCSASULZFIFFIN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(C3=C1C=CC=N3)O |
Computed by PubChem (NCBI)