CAS 1333549-25-9 is the registry number for 5-(6-Fluoro-1-(propan-2-yl)-1H-1,3-benzodiazol-2-yl)-2-methylaniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(6-fluoro-1-propan-2-ylbenzimidazol-2-yl)-2-methylaniline (CAS 1333549-25-9) is a chemical compound with the molecular formula C17H18FN3 and a molecular weight of 283.34 g/mol. IUPAC name: 5-(6-fluoro-1-propan-2-ylbenzimidazol-2-yl)-2-methylaniline. InChIKey: LARBKPMKBMFVKN-UHFFFAOYSA-N.
| Molecular formula | C17H18FN3 |
|---|---|
| Molecular weight | 283.34 g/mol |
| IUPAC name | 5-(6-fluoro-1-propan-2-ylbenzimidazol-2-yl)-2-methylaniline |
| InChIKey | LARBKPMKBMFVKN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NC3=C(N2C(C)C)C=C(C=C3)F)N |
Computed by PubChem (NCBI)