CAS 1334027-08-5 is the registry number for 4-(5-Fluoro-1-(propan-2-yl)-2,3-dihydro-1H-1,3-benzodiazol-2-ylidene)-2-methylcyclohexa-2,5-dien-1-imine. Offered by: Biosynth. Available pack sizes: 10g, 1g.
4-(5-fluoro-1-propan-2-ylbenzimidazol-2-yl)-2-methylaniline (CAS 1334027-08-5) is a chemical compound with the molecular formula C17H18FN3 and a molecular weight of 283.34 g/mol. IUPAC name: 4-(5-fluoro-1-propan-2-ylbenzimidazol-2-yl)-2-methylaniline. InChIKey: OERNJSKCHZJZKM-UHFFFAOYSA-N.
| Molecular formula | C17H18FN3 |
|---|---|
| Molecular weight | 283.34 g/mol |
| IUPAC name | 4-(5-fluoro-1-propan-2-ylbenzimidazol-2-yl)-2-methylaniline |
| InChIKey | OERNJSKCHZJZKM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=NC3=C(N2C(C)C)C=CC(=C3)F)N |
Computed by PubChem (NCBI)