Products 13337-64-9
CAS 13337-64-9 is the registry number for Ethyl 2,7,7-trimethyl-5-oxo-4-phenyl-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2,7,7-trimethyl-5-oxo-4-phenyl-1,4,6,8-tetrahydroquinoline-3-carboxylate (CAS 13337-64-9) is a chemical compound with the molecular formula C21H25NO3 and a molecular weight of 339.4 g/mol. IUPAC name: ethyl 2,7,7-trimethyl-5-oxo-4-phenyl-1,4,6,8-tetrahydroquinoline-3-carboxylate. InChIKey: BHUYANTVBSTZDM-UHFFFAOYSA-N.
| Molecular formula | C21H25NO3 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | ethyl 2,7,7-trimethyl-5-oxo-4-phenyl-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| InChIKey | BHUYANTVBSTZDM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC2=C(C1C3=CC=CC=C3)C(=O)CC(C2)(C)C)C |
Computed by PubChem (NCBI)