CAS 133565-46-5 appears in our catalog under these names: Fmoc–Ile–ol, Fmoc-L-isoleucinol 97%, Fmoc-l-isoleucinol, 97%, 97%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g.
9H-fluoren-9-ylmethyl N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]carbamate (CAS 133565-46-5) is a chemical compound with the molecular formula C21H25NO3 and a molecular weight of 339.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]carbamate. InChIKey: YMPMFRNXDNCNRH-VBKZILBWSA-N.
| Molecular formula | C21H25NO3 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]carbamate |
| InChIKey | YMPMFRNXDNCNRH-VBKZILBWSA-N |
| SMILES | CC[C@H](C)[C@@H](CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)