CAS 133384-73-3 is the registry number for (2,2-Dimethyl-1,3-dioxan-5-yl)methyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,2-dimethyl-1,3-dioxan-5-yl)methyl 4-methylbenzenesulfonate (CAS 133384-73-3) is a chemical compound with the molecular formula C14H20O5S and a molecular weight of 300.37 g/mol. IUPAC name: (2,2-dimethyl-1,3-dioxan-5-yl)methyl 4-methylbenzenesulfonate. InChIKey: PTLZUYYTWMVUEN-UHFFFAOYSA-N.
| Molecular formula | C14H20O5S |
|---|---|
| Molecular weight | 300.37 g/mol |
| IUPAC name | (2,2-dimethyl-1,3-dioxan-5-yl)methyl 4-methylbenzenesulfonate |
| InChIKey | PTLZUYYTWMVUEN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2COC(OC2)(C)C |
Computed by PubChem (NCBI)