Products 94284-00-1
CAS 94284-00-1 is the registry number for Methyl (2S,3S)-3-methyl-2-(tosyloxy)pentanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,3S)-3-methyl-2-(4-methylphenyl)sulfonyloxypentanoate (CAS 94284-00-1) is a chemical compound with the molecular formula C14H20O5S and a molecular weight of 300.37 g/mol. IUPAC name: methyl (2S,3S)-3-methyl-2-(4-methylphenyl)sulfonyloxypentanoate. InChIKey: RNLKQPJJHATCON-AAEUAGOBSA-N.
| Molecular formula | C14H20O5S |
|---|---|
| Molecular weight | 300.37 g/mol |
| IUPAC name | methyl (2S,3S)-3-methyl-2-(4-methylphenyl)sulfonyloxypentanoate |
| InChIKey | RNLKQPJJHATCON-AAEUAGOBSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC)OS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)