Products 1333913-43-1
CAS 1333913-43-1 is the registry number for 2-((2-(Thiophen-2-yl)ethyl)thio)pyrimidine-4,6-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-thiophen-2-ylethylsulfanyl)pyrimidine-4,6-diamine (CAS 1333913-43-1) is a chemical compound with the molecular formula C10H12N4S2 and a molecular weight of 252.4 g/mol. IUPAC name: 2-(2-thiophen-2-ylethylsulfanyl)pyrimidine-4,6-diamine. InChIKey: CTYCVMXMQQELKW-UHFFFAOYSA-N.
| Molecular formula | C10H12N4S2 |
|---|---|
| Molecular weight | 252.4 g/mol |
| IUPAC name | 2-(2-thiophen-2-ylethylsulfanyl)pyrimidine-4,6-diamine |
| InChIKey | CTYCVMXMQQELKW-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CCSC2=NC(=CC(=N2)N)N |
Computed by PubChem (NCBI)