Products 893642-52-9
CAS 893642-52-9 is the registry number for 4-Amino-5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-3-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1H-1,2,4-triazole-5-thione (CAS 893642-52-9) is a chemical compound with the molecular formula C10H12N4S2 and a molecular weight of 252.4 g/mol. IUPAC name: 4-amino-3-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1H-1,2,4-triazole-5-thione. InChIKey: XWPSRMOCIUFTCI-UHFFFAOYSA-N.
| Molecular formula | C10H12N4S2 |
|---|---|
| Molecular weight | 252.4 g/mol |
| IUPAC name | 4-amino-3-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1H-1,2,4-triazole-5-thione |
| InChIKey | XWPSRMOCIUFTCI-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=C(S2)C3=NNC(=S)N3N |
Computed by PubChem (NCBI)