CAS 133397-99-6 appears in our catalog under these names: (R)-1-(4-Chlorophenyl)-2-methylpropan-1-amine, 97%, (R)-1-(4-Chlorophenyl)-2-methylpropan-1-amine, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(1R)-1-(4-chlorophenyl)-2-methylpropan-1-amine (CAS 133397-99-6) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (1R)-1-(4-chlorophenyl)-2-methylpropan-1-amine. InChIKey: KAIHEXRERGCTPN-SNVBAGLBSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (1R)-1-(4-chlorophenyl)-2-methylpropan-1-amine |
| InChIKey | KAIHEXRERGCTPN-SNVBAGLBSA-N |
| SMILES | CC(C)[C@H](C1=CC=C(C=C1)Cl)N |
Computed by PubChem (NCBI)