Products 1334012-17-7
CAS 1334012-17-7 is the registry number for 3-(2,3-Dihydro-1,4-benzodioxine-6-sulfinyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfinyl)propanoic acid (CAS 1334012-17-7) is a chemical compound with the molecular formula C11H12O5S and a molecular weight of 256.28 g/mol. IUPAC name: 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfinyl)propanoic acid. InChIKey: PHYGIHOXGVLYEV-UHFFFAOYSA-N.
| Molecular formula | C11H12O5S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfinyl)propanoic acid |
| InChIKey | PHYGIHOXGVLYEV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)S(=O)CCC(=O)O |
Computed by PubChem (NCBI)