CAS 2940948-09-2 is the registry number for methyl 1,1-dioxo-3,5-dihydro-2H-4,1benzoxathiepine-8-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Methyl 1,1-dioxo-3,5-dihydro-2H-4,1lambda6-benzoxathiepine-8-carboxylate (CAS 2940948-09-2) is a chemical compound with the molecular formula C11H12O5S and a molecular weight of 256.28 g/mol. IUPAC name: methyl 1,1-dioxo-3,5-dihydro-2H-4,1lambda6-benzoxathiepine-8-carboxylate. InChIKey: XPBVCTGTQRZXBP-UHFFFAOYSA-N.
| Molecular formula | C11H12O5S |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | methyl 1,1-dioxo-3,5-dihydro-2H-4,1lambda6-benzoxathiepine-8-carboxylate |
| InChIKey | XPBVCTGTQRZXBP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(COCCS2(=O)=O)C=C1 |
Computed by PubChem (NCBI)