CAS 1334107-58-2 appears in our catalog under these names: Akt1&PKA–IN–1, Akt1&PKA-IN-1. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 25 mg, 100 mg, 50 mg, 1 mg.
N-[(S)-azetidin-3-yl-(3,4-dichlorophenyl)methyl]isoquinoline-6-carboxamide (CAS 1334107-58-2) is a chemical compound with the molecular formula C20H17Cl2N3O and a molecular weight of 386.3 g/mol. IUPAC name: N-[(S)-azetidin-3-yl-(3,4-dichlorophenyl)methyl]isoquinoline-6-carboxamide. InChIKey: TWAIYMKBHKNSRO-LJQANCHMSA-N.
| Molecular formula | C20H17Cl2N3O |
|---|---|
| Molecular weight | 386.3 g/mol |
| IUPAC name | N-[(S)-azetidin-3-yl-(3,4-dichlorophenyl)methyl]isoquinoline-6-carboxamide |
| InChIKey | TWAIYMKBHKNSRO-LJQANCHMSA-N |
| SMILES | C1C(CN1)[C@@H](C2=CC(=C(C=C2)Cl)Cl)NC(=O)C3=CC4=C(C=C3)C=NC=C4 |
Computed by PubChem (NCBI)