Products 1334108-00-7
CAS 1334108-00-7 is the registry number for Akt1&PKA-IN-2. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 5 mg, 100 mg, 10 mg, 1 mg.
N-[(R)-azetidin-3-yl-(3,4-dichlorophenyl)methyl]isoquinoline-6-carboxamide (CAS 1334108-00-7) is a chemical compound with the molecular formula C20H17Cl2N3O and a molecular weight of 386.3 g/mol. IUPAC name: N-[(R)-azetidin-3-yl-(3,4-dichlorophenyl)methyl]isoquinoline-6-carboxamide. InChIKey: TWAIYMKBHKNSRO-IBGZPJMESA-N.
| Molecular formula | C20H17Cl2N3O |
|---|---|
| Molecular weight | 386.3 g/mol |
| IUPAC name | N-[(R)-azetidin-3-yl-(3,4-dichlorophenyl)methyl]isoquinoline-6-carboxamide |
| InChIKey | TWAIYMKBHKNSRO-IBGZPJMESA-N |
| SMILES | C1C(CN1)[C@H](C2=CC(=C(C=C2)Cl)Cl)NC(=O)C3=CC4=C(C=C3)C=NC=C4 |
Computed by PubChem (NCBI)