CAS 1334147-65-7 appears in our catalog under these names: 3-(4-tert-Butyl-1,3-thiazol-2-yl)phenol hydrochloride, 95%, 3-(4-tert-Butyl-1,3-thiazol-2-yl)phenol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(4-tert-butyl-1,3-thiazol-2-yl)phenol;hydrochloride (CAS 1334147-65-7) is a chemical compound with the molecular formula C13H16ClNOS and a molecular weight of 269.79 g/mol. IUPAC name: 3-(4-tert-butyl-1,3-thiazol-2-yl)phenol;hydrochloride. InChIKey: ULPNSPXQNLXVRG-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNOS |
|---|---|
| Molecular weight | 269.79 g/mol |
| IUPAC name | 3-(4-tert-butyl-1,3-thiazol-2-yl)phenol;hydrochloride |
| InChIKey | ULPNSPXQNLXVRG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CSC(=N1)C2=CC(=CC=C2)O.Cl |
Computed by PubChem (NCBI)