CAS 4568-71-2 appears in our catalog under these names: 3-BENZYL-5-(2-HYDROXYETHYL)-4-METHYL-, 3–Benzyl–5–(2–hydroxyethyl)–4–methylthiazolium chloride, 3-Benzyl-5-(2-hydroxyethyl)-4-methylthiazolium chloride, 98%, 3-Benzyl-5-(2-hydroxyethyl)-4-methylthiazolium Chloride, >98.0%(HPLC)(T), 3-Benzyl-5-(2-hydroxyethyl)-4-methylthiazol-3-ium chloride 98%. Offered by: Sigma-Aldrich, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), TCI. Available pack sizes: 25G, 100g, 500g, 5g, 1000g, 10g, 1kg.
2-(3-benzyl-4-methyl-1,3-thiazol-3-ium-5-yl)ethanol chloride (CAS 4568-71-2) is a chemical compound with the molecular formula C13H16ClNOS and a molecular weight of 269.79 g/mol. IUPAC name: 2-(3-benzyl-4-methyl-1,3-thiazol-3-ium-5-yl)ethanol chloride. InChIKey: IWSVLBKHBJGMAA-UHFFFAOYSA-M.
| Molecular formula | C13H16ClNOS |
|---|---|
| Molecular weight | 269.79 g/mol |
| IUPAC name | 2-(3-benzyl-4-methyl-1,3-thiazol-3-ium-5-yl)ethanol chloride |
| InChIKey | IWSVLBKHBJGMAA-UHFFFAOYSA-M |
| SMILES | CC1=C(SC=[N+]1CC2=CC=CC=C2)CCO.[Cl-] |
Computed by PubChem (NCBI)