CAS 1334149-56-2 appears in our catalog under these names: tert-Butyl 4-cyano-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate, 95%, tert-Butyl 4-cyano-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Tert-butyl 4-cyano-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (CAS 1334149-56-2) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl 4-cyano-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: DFZYOAIWAGMKET-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl 4-cyano-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | DFZYOAIWAGMKET-UHFFFAOYSA-N |
| SMILES | CC1C(N(C(O1)(C)C)C(=O)OC(C)(C)C)C#N |
Computed by PubChem (NCBI)