Products 1334160-80-3
CAS 1334160-80-3 appears in our catalog under these names: (S)-3-(Trifluoromethyl)pyrrolidine-3-carboxylic acid, 97%, (3S)-3-(Trifluoromethyl)pyrrolidine-3-carboxylic acid, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(3S)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (CAS 1334160-80-3) is a chemical compound with the molecular formula C6H8F3NO2 and a molecular weight of 183.13 g/mol. IUPAC name: (3S)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid. InChIKey: VEUBBZBEISLEIY-YFKPBYRVSA-N.
| Molecular formula | C6H8F3NO2 |
|---|---|
| Molecular weight | 183.13 g/mol |
| IUPAC name | (3S)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| InChIKey | VEUBBZBEISLEIY-YFKPBYRVSA-N |
| SMILES | C1CNC[C@@]1(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)