CAS 1334226-26-4 appears in our catalog under these names: 5-[(diethylamino)methyl]-2-fluorophenylboronic acid, 95%, (5–((diethylamino)Methyl)–2–fluorophenyl)boronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
[5-(diethylaminomethyl)-2-fluorophenyl]boronic acid (CAS 1334226-26-4) is a chemical compound with the molecular formula C11H17BFNO2 and a molecular weight of 225.07 g/mol. IUPAC name: [5-(diethylaminomethyl)-2-fluorophenyl]boronic acid. InChIKey: OICZMAWKLZLVRD-UHFFFAOYSA-N.
| Molecular formula | C11H17BFNO2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | [5-(diethylaminomethyl)-2-fluorophenyl]boronic acid |
| InChIKey | OICZMAWKLZLVRD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)CN(CC)CC)F)(O)O |
Computed by PubChem (NCBI)