CAS 1704066-81-8 appears in our catalog under these names: 3-((Diethylamino)methyl)-5-fluorophenylboronic acid, 95%, 3–((Diethylamino)methyl)–5–fluorophenylboronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
[3-(diethylaminomethyl)-5-fluorophenyl]boronic acid (CAS 1704066-81-8) is a chemical compound with the molecular formula C11H17BFNO2 and a molecular weight of 225.07 g/mol. IUPAC name: [3-(diethylaminomethyl)-5-fluorophenyl]boronic acid. InChIKey: SYUPANXFMFMRFG-UHFFFAOYSA-N.
| Molecular formula | C11H17BFNO2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | [3-(diethylaminomethyl)-5-fluorophenyl]boronic acid |
| InChIKey | SYUPANXFMFMRFG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)CN(CC)CC)(O)O |
Computed by PubChem (NCBI)