CAS 1334415-35-8 is the registry number for 1-tert-Butyl 3,3-dimethyl 4-oxopiperidine-1,3,3-tricarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-O-tert-butyl 3-O,3-O'-dimethyl 4-oxopiperidine-1,3,3-tricarboxylate (CAS 1334415-35-8) is a chemical compound with the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. IUPAC name: 1-O-tert-butyl 3-O,3-O'-dimethyl 4-oxopiperidine-1,3,3-tricarboxylate. InChIKey: CKZPPMZDPBOOMP-UHFFFAOYSA-N.
| Molecular formula | C14H21NO7 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O,3-O'-dimethyl 4-oxopiperidine-1,3,3-tricarboxylate |
| InChIKey | CKZPPMZDPBOOMP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(C1)(C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)