Products 1334415-35-8

CAS 1334415-35-8 is the registry number for 1-tert-Butyl 3,3-dimethyl 4-oxopiperidine-1,3,3-tricarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

1-O-tert-butyl 3-O,3-O'-dimethyl 4-oxopiperidine-1,3,3-tricarboxylate (CAS 1334415-35-8) is a chemical compound with the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. IUPAC name: 1-O-tert-butyl 3-O,3-O'-dimethyl 4-oxopiperidine-1,3,3-tricarboxylate. InChIKey: CKZPPMZDPBOOMP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21NO7
Molecular weight315.32 g/mol
IUPAC name1-O-tert-butyl 3-O,3-O'-dimethyl 4-oxopiperidine-1,3,3-tricarboxylate
InChIKeyCKZPPMZDPBOOMP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(=O)C(C1)(C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)