CAS 865364-92-7 is the registry number for tert-Butyl (3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-3-hydroxypropyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-oxopropyl]carbamate (CAS 865364-92-7) is a chemical compound with the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. IUPAC name: tert-butyl N-[3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-oxopropyl]carbamate. InChIKey: BTXIPOJKDQOLSU-UHFFFAOYSA-N.
| Molecular formula | C14H21NO7 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | tert-butyl N-[3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-oxopropyl]carbamate |
| InChIKey | BTXIPOJKDQOLSU-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)C(=O)CCNC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)