Products 133453-58-4
CAS 133453-58-4 appears in our catalog under these names: Heudelotinone, Heudelotine. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
(8R)-14-hydroxy-7,7,13-trimethyltricyclo[9.4.0.03,8]pentadeca-1(11),2,4,12,14-pentaen-6-one (CAS 133453-58-4) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 268.3 g/mol. IUPAC name: (8R)-14-hydroxy-7,7,13-trimethyltricyclo[9.4.0.03,8]pentadeca-1(11),2,4,12,14-pentaen-6-one. InChIKey: CGDLYSDMNSOBAM-OAHLLOKOSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | (8R)-14-hydroxy-7,7,13-trimethyltricyclo[9.4.0.03,8]pentadeca-1(11),2,4,12,14-pentaen-6-one |
| InChIKey | CGDLYSDMNSOBAM-OAHLLOKOSA-N |
| SMILES | CC1=CC2=C(C=C3C=CC(=O)C([C@@H]3CC2)(C)C)C=C1O |
Computed by PubChem (NCBI)