Products 1334532-24-9
CAS 1334532-24-9 appears in our catalog under these names: Octanoyl L-Carnitine-d3 Chloride, >95% (HPLC), Octanoyl-L-carnitine-d3 HCl (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, Octanoyl–L–carnitine–d3 (chloride), Octanoyl-L-carnitine-d3 (chloride), 99.97%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 0,05g, 0,01g, 1mg, 5 mg.
[(2R)-3-carboxy-2-octanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride (CAS 1334532-24-9) is a chemical compound with the molecular formula C15H30ClNO4 and a molecular weight of 326.87 g/mol. IUPAC name: [(2R)-3-carboxy-2-octanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride. InChIKey: MYMFUYYXIJGKKU-HZUATLIXSA-N.
| Molecular formula | C15H30ClNO4 |
|---|---|
| Molecular weight | 326.87 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-octanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride |
| InChIKey | MYMFUYYXIJGKKU-HZUATLIXSA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CCCCCCC.[Cl-] |
Computed by PubChem (NCBI)