CAS 18822-86-1 appears in our catalog under these names: (±)-Octanoylcarnitine Chloride, (±)–Octanoylcarnitine chloride, (±)-Octanoylcarnitine chloride, ≥98%, ≥98%. Offered by: TRC, GLPBio, Chemat. Available pack sizes: 1mg, 2,5mg, 5mg, 50mg.
(3-carboxy-2-octanoyloxypropyl)-trimethylazanium chloride (CAS 18822-86-1) is a chemical compound with the molecular formula C15H30ClNO4 and a molecular weight of 323.85 g/mol. IUPAC name: (3-carboxy-2-octanoyloxypropyl)-trimethylazanium chloride. InChIKey: MYMFUYYXIJGKKU-UHFFFAOYSA-N.
| Molecular formula | C15H30ClNO4 |
|---|---|
| Molecular weight | 323.85 g/mol |
| IUPAC name | (3-carboxy-2-octanoyloxypropyl)-trimethylazanium chloride |
| InChIKey | MYMFUYYXIJGKKU-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OC(CC(=O)O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)