Products 1334681-27-4

CAS 1334681-27-4 is the registry number for Trans-4-(3-hydroxypropenyl)piperidine-1-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Benzyl 4-[(E)-3-hydroxyprop-1-enyl]piperidine-1-carboxylate (CAS 1334681-27-4) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 275.34 g/mol. IUPAC name: benzyl 4-[(E)-3-hydroxyprop-1-enyl]piperidine-1-carboxylate. InChIKey: RBEUOISBJWMSBJ-QPJJXVBHSA-N.

Identity
Molecular formulaC16H21NO3
Molecular weight275.34 g/mol
IUPAC namebenzyl 4-[(E)-3-hydroxyprop-1-enyl]piperidine-1-carboxylate
InChIKeyRBEUOISBJWMSBJ-QPJJXVBHSA-N
SMILESC1CN(CCC1/C=C/CO)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)