CAS 133486-61-0 is the registry number for 4-(Bromomethyl)-3-chlorobenzoic acid ethyl ester, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 4-(bromomethyl)-3-chlorobenzoate (CAS 133486-61-0) is a chemical compound with the molecular formula C10H10BrClO2 and a molecular weight of 277.54 g/mol. IUPAC name: ethyl 4-(bromomethyl)-3-chlorobenzoate. InChIKey: MMYLSWWUUOOTSK-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO2 |
|---|---|
| Molecular weight | 277.54 g/mol |
| IUPAC name | ethyl 4-(bromomethyl)-3-chlorobenzoate |
| InChIKey | MMYLSWWUUOOTSK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)CBr)Cl |
Computed by PubChem (NCBI)