CAS 1335042-74-4 is the registry number for Boc-NH-3,4-dimethylpent-4-enal. Offered by: Iris Biotech. Available pack sizes: 1g.
Tert-butyl N-(2,3-dimethyl-5-oxopent-1-en-3-yl)carbamate (CAS 1335042-74-4) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl N-(2,3-dimethyl-5-oxopent-1-en-3-yl)carbamate. InChIKey: GVLWYYDPDKGZID-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl N-(2,3-dimethyl-5-oxopent-1-en-3-yl)carbamate |
| InChIKey | GVLWYYDPDKGZID-UHFFFAOYSA-N |
| SMILES | CC(=C)C(C)(CC=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)