Products 1335203-38-7
CAS 1335203-38-7 is the registry number for 2-Amino-4-isopropoxybenzoic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-amino-4-propan-2-yloxybenzoic acid (CAS 1335203-38-7) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 2-amino-4-propan-2-yloxybenzoic acid. InChIKey: KTZDGVKBSMLMNZ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 2-amino-4-propan-2-yloxybenzoic acid |
| InChIKey | KTZDGVKBSMLMNZ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C=C1)C(=O)O)N |
Computed by PubChem (NCBI)