CAS 1336205-71-0 is the registry number for H-L-Phe(2,4,5-Me3)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg.
(2S)-2-amino-3-(2,4,5-trimethylphenyl)propanoic acid (CAS 1336205-71-0) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: (2S)-2-amino-3-(2,4,5-trimethylphenyl)propanoic acid. InChIKey: HWBNGCUVGLKXNP-NSHDSACASA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,4,5-trimethylphenyl)propanoic acid |
| InChIKey | HWBNGCUVGLKXNP-NSHDSACASA-N |
| SMILES | CC1=CC(=C(C=C1C)C[C@@H](C(=O)O)N)C |
Computed by PubChem (NCBI)