Products 1336231-14-1
CAS 1336231-14-1 is the registry number for (S)-6-bromo-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-6-bromo-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1336231-14-1) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: (1S)-6-bromo-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: RPJWDUSFMDKAGY-JTQLQIEISA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | (1S)-6-bromo-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | RPJWDUSFMDKAGY-JTQLQIEISA-N |
| SMILES | COC1=C(C=CC2=C1CCC[C@@H]2N)Br |
Computed by PubChem (NCBI)