CAS 1336574-07-2 is the registry number for (R)-2-Amino-4-methoxy-3,3-dimethyl-4-oxobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-4-methoxy-3,3-dimethyl-4-oxobutanoic acid (CAS 1336574-07-2) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. IUPAC name: (2R)-2-amino-4-methoxy-3,3-dimethyl-4-oxobutanoic acid. InChIKey: UIIKWTKJGVDONY-BYPYZUCNSA-N.
| Molecular formula | C7H13NO4 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | (2R)-2-amino-4-methoxy-3,3-dimethyl-4-oxobutanoic acid |
| InChIKey | UIIKWTKJGVDONY-BYPYZUCNSA-N |
| SMILES | CC(C)([C@H](C(=O)O)N)C(=O)OC |
Computed by PubChem (NCBI)