CAS 204919-53-9 is the registry number for tert-Butyl 3-nitropropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 3-nitropropanoate (CAS 204919-53-9) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. IUPAC name: tert-butyl 3-nitropropanoate. InChIKey: QHYQEYIFTIIWFH-UHFFFAOYSA-N.
| Molecular formula | C7H13NO4 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | tert-butyl 3-nitropropanoate |
| InChIKey | QHYQEYIFTIIWFH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC[N+](=O)[O-] |
Computed by PubChem (NCBI)