Products 1336951-42-8
CAS 1336951-42-8 is the registry number for 7-Amino-1-oxo-2,3-dihydro-1H-indene-4-carbonitrile, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
7-amino-1-oxo-2,3-dihydroindene-4-carbonitrile (CAS 1336951-42-8) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 7-amino-1-oxo-2,3-dihydroindene-4-carbonitrile. InChIKey: QLLTUFJESTWWKW-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 7-amino-1-oxo-2,3-dihydroindene-4-carbonitrile |
| InChIKey | QLLTUFJESTWWKW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)C#N)N |
Computed by PubChem (NCBI)