Products 1336986-09-4
CAS 1336986-09-4 is the registry number for 2–Azido–2–(6–chlorophenyl)cyclohexanone–d4. Offered by: GLPBio. Available pack sizes: 10mg.
2-azido-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one (CAS 1336986-09-4) is a chemical compound with the molecular formula C12H12ClN3O and a molecular weight of 253.72 g/mol. IUPAC name: 2-azido-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one. InChIKey: QCWNUOLEUGUXCR-NMRLXUNGSA-N.
| Molecular formula | C12H12ClN3O |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | 2-azido-2-(2-chloro-3,4,5,6-tetradeuteriophenyl)cyclohexan-1-one |
| InChIKey | QCWNUOLEUGUXCR-NMRLXUNGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2(CCCCC2=O)N=[N+]=[N-])Cl)[2H])[2H] |
Computed by PubChem (NCBI)