CAS 1337051-57-6 is the registry number for Cyclopropyl(3,4-dibromophenyl)methanamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclopropyl-(3,4-dibromophenyl)methanamine (CAS 1337051-57-6) is a chemical compound with the molecular formula C10H11Br2N and a molecular weight of 305.01 g/mol. IUPAC name: cyclopropyl-(3,4-dibromophenyl)methanamine. InChIKey: PBNGJYNVBBUBCV-UHFFFAOYSA-N.
| Molecular formula | C10H11Br2N |
|---|---|
| Molecular weight | 305.01 g/mol |
| IUPAC name | cyclopropyl-(3,4-dibromophenyl)methanamine |
| InChIKey | PBNGJYNVBBUBCV-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC(=C(C=C2)Br)Br)N |
Computed by PubChem (NCBI)