CAS 1872736-32-7 is the registry number for 1-(3,4-Dibromobenzyl)azetidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(3,4-dibromophenyl)methyl]azetidine (CAS 1872736-32-7) is a chemical compound with the molecular formula C10H11Br2N and a molecular weight of 305.01 g/mol. IUPAC name: 1-[(3,4-dibromophenyl)methyl]azetidine. InChIKey: ZMELTGZNPDMILY-UHFFFAOYSA-N.
| Molecular formula | C10H11Br2N |
|---|---|
| Molecular weight | 305.01 g/mol |
| IUPAC name | 1-[(3,4-dibromophenyl)methyl]azetidine |
| InChIKey | ZMELTGZNPDMILY-UHFFFAOYSA-N |
| SMILES | C1CN(C1)CC2=CC(=C(C=C2)Br)Br |
Computed by PubChem (NCBI)