CAS 13372-52-6 appears in our catalog under these names: 1-(3-Fluoro-4-methanesulfonylphenyl)ethan-1-one, 95%, 3'-Fluoro-4'-(methylsulphonyl)acetophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
1-(3-fluoro-4-methylsulfonylphenyl)ethanone (CAS 13372-52-6) is a chemical compound with the molecular formula C9H9FO3S and a molecular weight of 216.23 g/mol. IUPAC name: 1-(3-fluoro-4-methylsulfonylphenyl)ethanone. InChIKey: IAZKXACVKHEXCR-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3S |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 1-(3-fluoro-4-methylsulfonylphenyl)ethanone |
| InChIKey | IAZKXACVKHEXCR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)S(=O)(=O)C)F |
Computed by PubChem (NCBI)